C32H39N7O6 — CID 18916638
ethyl 2-[2-(5-carbamimidoyl-2-ethoxyphenoxy)-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-9-yl]-4-methylpentanoate (PubChem CID 18916638) has the molecular formula C32H39N7O6 and a molecular weight of 617.71 g/mol. Its IUPAC name is ethyl 2-[2-(5-carbamimidoyl-2-ethoxyphenoxy)-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-9-yl]-4-methylpentanoate.
| Compound Name | ethyl 2-[2-(5-carbamimidoyl-2-ethoxyphenoxy)-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-9-yl]-4-methylpentanoate |
|---|---|
| PubChem CID | 18916638 |
| Molecular Formula | C32H39N7O6 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | ethyl 2-[2-(5-carbamimidoyl-2-ethoxyphenoxy)-6-[3-(dimethylcarbamoyl)phenoxy]-8-methylpurin-9-yl]-4-methylpentanoate |
| SMILES | [H]/N=C(\N)c1ccc(OCC)c(Oc2nc(Oc3cccc(C(=O)N(C)C)c3)c3nc(C)n(C(CC(C)C)C(=O)OCC)c3n2)c1 |
| InChI | InChI=1S/C32H39N7O6/c1-8-42-24-14-13-20(27(33)34)17-25(24)45-32-36-28-26(35-19(5)39(28)23(15-18(3)4)31(41)43-9-2)29(37-32)44-22-12-10-11-21(16-22)30(40)38(6)7/h10-14,16-18,23H,8-9,15H2,1-7H3,(H3,33,34) |
| InChIKey | MXYWAWSMTSRJJV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|