C23H22F2N4O4 — CID 10623670
3-[[6-(5-carbamimidoyl-2-methoxyphenoxy)-3,5-difluoro-4-methyl-2-pyridinyl]oxy]-N,N-dimethylbenzamide (PubChem CID 10623670) has the molecular formula C23H22F2N4O4 and a molecular weight of 456.45 g/mol. Its IUPAC name is 3-[[6-(5-carbamimidoyl-2-methoxyphenoxy)-3,5-difluoro-4-methyl-2-pyridinyl]oxy]-N,N-dimethylbenzamide.
| Compound Name | 3-[[6-(5-carbamimidoyl-2-methoxyphenoxy)-3,5-difluoro-4-methyl-2-pyridinyl]oxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 10623670 |
| Molecular Formula | C23H22F2N4O4 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[[6-(5-carbamimidoyl-2-methoxyphenoxy)-3,5-difluoro-4-methyl-2-pyridinyl]oxy]-N,N-dimethylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(OC)c(Oc2nc(Oc3cccc(C(=O)N(C)C)c3)c(F)c(C)c2F)c1 |
| InChI | InChI=1S/C23H22F2N4O4/c1-12-18(24)21(32-15-7-5-6-14(10-15)23(30)29(2)3)28-22(19(12)25)33-17-11-13(20(26)27)8-9-16(17)31-4/h5-11H,1-4H3,(H3,26,27) |
| InChIKey | YFRQQLMNZPPWOI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|