C20H14F5N3O2 — CID 11122714
3-[[3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]oxy]benzenecarboximidamide (PubChem CID 11122714) has the molecular formula C20H14F5N3O2 and a molecular weight of 423.34 g/mol. Its IUPAC name is 3-[[3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]oxy]benzenecarboximidamide.
| Compound Name | 3-[[3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]oxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 11122714 |
| Molecular Formula | C20H14F5N3O2 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 3-[[3,5-difluoro-4-methyl-6-[3-(trifluoromethyl)phenoxy]-2-pyridinyl]oxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(Oc2nc(Oc3cccc(C(F)(F)F)c3)c(F)c(C)c2F)c1 |
| InChI | InChI=1S/C20H14F5N3O2/c1-10-15(21)18(29-13-6-2-4-11(8-13)17(26)27)28-19(16(10)22)30-14-7-3-5-12(9-14)20(23,24)25/h2-9H,1H3,(H3,26,27) |
| InChIKey | SUJUCOWQSJUBAX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|