C21H21F2N5O2 — CID 23441607
4-[[6-[3-(dimethylamino)phenoxy]-3,5-difluoro-4-methyl-2-pyridinyl]amino]-3-hydroxybenzenecarboximidamide (PubChem CID 23441607) has the molecular formula C21H21F2N5O2 and a molecular weight of 413.43 g/mol. Its IUPAC name is 4-[[6-[3-(dimethylamino)phenoxy]-3,5-difluoro-4-methyl-2-pyridinyl]amino]-3-hydroxybenzenecarboximidamide.
| Compound Name | 4-[[6-[3-(dimethylamino)phenoxy]-3,5-difluoro-4-methyl-2-pyridinyl]amino]-3-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 23441607 |
| Molecular Formula | C21H21F2N5O2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 4-[[6-[3-(dimethylamino)phenoxy]-3,5-difluoro-4-methyl-2-pyridinyl]amino]-3-hydroxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Nc2nc(Oc3cccc(N(C)C)c3)c(F)c(C)c2F)c(O)c1 |
| InChI | InChI=1S/C21H21F2N5O2/c1-11-17(22)20(26-15-8-7-12(19(24)25)9-16(15)29)27-21(18(11)23)30-14-6-4-5-13(10-14)28(2)3/h4-10,29H,1-3H3,(H3,24,25)(H,26,27) |
| InChIKey | CYDTWTNQKPBJLI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|