C20H18F2N6O — CID 10668443
3-[[6-(3-carbamimidoylphenoxy)-3,5-difluoro-4-methyl-2-pyridinyl]amino]benzenecarboximidamide (PubChem CID 10668443) has the molecular formula C20H18F2N6O and a molecular weight of 396.40 g/mol. Its IUPAC name is 3-[[6-(3-carbamimidoylphenoxy)-3,5-difluoro-4-methyl-2-pyridinyl]amino]benzenecarboximidamide.
| Compound Name | 3-[[6-(3-carbamimidoylphenoxy)-3,5-difluoro-4-methyl-2-pyridinyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 10668443 |
| Molecular Formula | C20H18F2N6O |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 3-[[6-(3-carbamimidoylphenoxy)-3,5-difluoro-4-methyl-2-pyridinyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(Nc2nc(Oc3cccc(/C(N)=N/[H])c3)c(F)c(C)c2F)c1 |
| InChI | InChI=1S/C20H18F2N6O/c1-10-15(21)19(27-13-6-2-4-11(8-13)17(23)24)28-20(16(10)22)29-14-7-3-5-12(9-14)18(25)26/h2-9H,1H3,(H3,23,24)(H3,25,26)(H,27,28) |
| InChIKey | WFNZWAUCNYWALG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 133.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|