C28H32N8O5 — CID 18916764
3-[9-(1-amino-3-methyl-1-oxobutan-2-yl)-2-(5-carbamimidoyl-2-methoxyphenoxy)-8-methylpurin-6-yl]oxy-N,N-dimethylbenzamide (PubChem CID 18916764) has the molecular formula C28H32N8O5 and a molecular weight of 560.62 g/mol. Its IUPAC name is 3-[9-(1-amino-3-methyl-1-oxobutan-2-yl)-2-(5-carbamimidoyl-2-methoxyphenoxy)-8-methylpurin-6-yl]oxy-N,N-dimethylbenzamide.
| Compound Name | 3-[9-(1-amino-3-methyl-1-oxobutan-2-yl)-2-(5-carbamimidoyl-2-methoxyphenoxy)-8-methylpurin-6-yl]oxy-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 18916764 |
| Molecular Formula | C28H32N8O5 |
| Molecular Weight | 560.62 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 3-[9-(1-amino-3-methyl-1-oxobutan-2-yl)-2-(5-carbamimidoyl-2-methoxyphenoxy)-8-methylpurin-6-yl]oxy-N,N-dimethylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(OC)c(Oc2nc(Oc3cccc(C(=O)N(C)C)c3)c3nc(C)n(C(C(N)=O)C(C)C)c3n2)c1 |
| InChI | InChI=1S/C28H32N8O5/c1-14(2)22(24(31)37)36-15(3)32-21-25(36)33-28(41-20-13-16(23(29)30)10-11-19(20)39-6)34-26(21)40-18-9-7-8-17(12-18)27(38)35(4)5/h7-14,22H,1-6H3,(H3,29,30)(H2,31,37) |
| InChIKey | JQKFXFRAKQSCHG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 184.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|