C22H22N8O3 — CID 18916768
3-[[6-(3-amino-4-carbamimidoylphenoxy)-8-methyl-7H-purin-2-yl]oxy]-N,N-dimethylbenzamide (PubChem CID 18916768) has the molecular formula C22H22N8O3 and a molecular weight of 446.47 g/mol. Its IUPAC name is 3-[[6-(3-amino-4-carbamimidoylphenoxy)-8-methyl-7H-purin-2-yl]oxy]-N,N-dimethylbenzamide.
| Compound Name | 3-[[6-(3-amino-4-carbamimidoylphenoxy)-8-methyl-7H-purin-2-yl]oxy]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 18916768 |
| Molecular Formula | C22H22N8O3 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 3-[[6-(3-amino-4-carbamimidoylphenoxy)-8-methyl-7H-purin-2-yl]oxy]-N,N-dimethylbenzamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2nc(Oc3cccc(C(=O)N(C)C)c3)nc3nc(C)[nH]c23)cc1N |
| InChI | InChI=1S/C22H22N8O3/c1-11-26-17-19(27-11)28-22(33-13-6-4-5-12(9-13)21(31)30(2)3)29-20(17)32-14-7-8-15(18(24)25)16(23)10-14/h4-10H,23H2,1-3H3,(H3,24,25)(H,26,27,28,29) |
| InChIKey | SGNWGINIVQQVLT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 169.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|