C26H21N6O5+ — CID 123537459
[amino-[3-[[6-(3-carboxyphenoxy)-8-methyl-7H-purin-2-yl]oxy]-4-phenoxyphenyl]methylidene]azanium (PubChem CID 123537459) has the molecular formula C26H21N6O5+ and a molecular weight of 497.49 g/mol. Its IUPAC name is [amino-[3-[[6-(3-carboxyphenoxy)-8-methyl-7H-purin-2-yl]oxy]-4-phenoxyphenyl]methylidene]azanium.
| Compound Name | [amino-[3-[[6-(3-carboxyphenoxy)-8-methyl-7H-purin-2-yl]oxy]-4-phenoxyphenyl]methylidene]azanium |
|---|---|
| PubChem CID | 123537459 |
| Molecular Formula | C26H21N6O5+ |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | [amino-[3-[[6-(3-carboxyphenoxy)-8-methyl-7H-purin-2-yl]oxy]-4-phenoxyphenyl]methylidene]azanium |
| SMILES | Cc1nc2nc(Oc3cc(C(N)=[NH2+])ccc3Oc3ccccc3)nc(Oc3cccc(C(=O)O)c3)c2[nH]1 |
| InChI | InChI=1S/C26H20N6O5/c1-14-29-21-23(30-14)31-26(32-24(21)36-18-9-5-6-16(12-18)25(33)34)37-20-13-15(22(27)28)10-11-19(20)35-17-7-3-2-4-8-17/h2-13H,1H3,(H3,27,28)(H,33,34)(H,29,30,31,32)/p+1 |
| InChIKey | WFBOFJHETUZZSR-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 171.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|