C32H33N9O2 — CID 18917022
4-[9-benzyl-8-methyl-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]purin-6-yl]oxy-2-(dimethylamino)benzenecarboximidamide (PubChem CID 18917022) has the molecular formula C32H33N9O2 and a molecular weight of 575.68 g/mol. Its IUPAC name is 4-[9-benzyl-8-methyl-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]purin-6-yl]oxy-2-(dimethylamino)benzenecarboximidamide.
| Compound Name | 4-[9-benzyl-8-methyl-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]purin-6-yl]oxy-2-(dimethylamino)benzenecarboximidamide |
|---|---|
| PubChem CID | 18917022 |
| Molecular Formula | C32H33N9O2 |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | 4-[9-benzyl-8-methyl-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]purin-6-yl]oxy-2-(dimethylamino)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Oc2nc(Oc3cccc(C4=NCCN4C)c3)nc3c2nc(C)n3Cc2ccccc2)cc1N(C)C |
| InChI | InChI=1S/C32H33N9O2/c1-20-36-27-30(41(20)19-21-9-6-5-7-10-21)37-32(43-23-12-8-11-22(17-23)29-35-15-16-40(29)4)38-31(27)42-24-13-14-25(28(33)34)26(18-24)39(2)3/h5-14,17-18H,15-16,19H2,1-4H3,(H3,33,34) |
| InChIKey | VFQLYLOJDHUESX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|