C27H23N9O2 — CID 142643041
2-[3-[2-(2-amino-5-cyanophenoxy)-9-benzyl-8-methylpurin-6-yl]oxyphenyl]guanidine (PubChem CID 142643041) has the molecular formula C27H23N9O2 and a molecular weight of 505.54 g/mol. Its IUPAC name is 2-[3-[2-(2-amino-5-cyanophenoxy)-9-benzyl-8-methylpurin-6-yl]oxyphenyl]guanidine.
| Compound Name | 2-[3-[2-(2-amino-5-cyanophenoxy)-9-benzyl-8-methylpurin-6-yl]oxyphenyl]guanidine |
|---|---|
| PubChem CID | 142643041 |
| Molecular Formula | C27H23N9O2 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | 2-[3-[2-(2-amino-5-cyanophenoxy)-9-benzyl-8-methylpurin-6-yl]oxyphenyl]guanidine |
| SMILES | Cc1nc2c(Oc3cccc(N=C(N)N)c3)nc(Oc3cc(C#N)ccc3N)nc2n1Cc1ccccc1 |
| InChI | InChI=1S/C27H23N9O2/c1-16-32-23-24(36(16)15-17-6-3-2-4-7-17)34-27(38-22-12-18(14-28)10-11-21(22)29)35-25(23)37-20-9-5-8-19(13-20)33-26(30)31/h2-13H,15,29H2,1H3,(H4,30,31,33) |
| InChIKey | CJYIYJRLPNZFFQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 176.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|