C26H26N8O9 — CID 22102680
2-[[6-[5-cyano-2-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]-2-[3-(diaminomethylideneamino)phenoxy]-5-nitropyrimidin-4-yl]amino]-3-hydroxypropanoic acid (PubChem CID 22102680) has the molecular formula C26H26N8O9 and a molecular weight of 594.54 g/mol. Its IUPAC name is 2-[[6-[5-cyano-2-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]-2-[3-(diaminomethylideneamino)phenoxy]-5-nitropyrimidin-4-yl]amino]-3-hydroxypropanoic acid.
| Compound Name | 2-[[6-[5-cyano-2-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]-2-[3-(diaminomethylideneamino)phenoxy]-5-nitropyrimidin-4-yl]amino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 22102680 |
| Molecular Formula | C26H26N8O9 |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | 2-[[6-[5-cyano-2-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]-2-[3-(diaminomethylideneamino)phenoxy]-5-nitropyrimidin-4-yl]amino]-3-hydroxypropanoic acid |
| SMILES | CC(C)(C)OC(=O)c1ccc(C#N)cc1Oc1nc(Oc2cccc(N=C(N)N)c2)nc(NC(CO)C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C26H26N8O9/c1-26(2,3)43-23(38)16-8-7-13(11-27)9-18(16)42-21-19(34(39)40)20(31-17(12-35)22(36)37)32-25(33-21)41-15-6-4-5-14(10-15)30-24(28)29/h4-10,17,35H,12H2,1-3H3,(H,36,37)(H4,28,29,30)(H,31,32,33) |
| InChIKey | PZMSVFPMCQREJM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 271.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|