C33H31N7O6 — CID 18916785
tert-butyl 2-[6-(benzylamino)-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-cyanobenzoate (PubChem CID 18916785) has the molecular formula C33H31N7O6 and a molecular weight of 621.65 g/mol. Its IUPAC name is tert-butyl 2-[6-(benzylamino)-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-cyanobenzoate.
| Compound Name | tert-butyl 2-[6-(benzylamino)-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-cyanobenzoate |
|---|---|
| PubChem CID | 18916785 |
| Molecular Formula | C33H31N7O6 |
| Molecular Weight | 621.65 g/mol |
| Exact Mass | 621.23 |
| IUPAC Name | tert-butyl 2-[6-(benzylamino)-2-[3-(1-methyl-4,5-dihydroimidazol-2-yl)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-cyanobenzoate |
| SMILES | CN1CCN=C1c1cccc(Oc2nc(NCc3ccccc3)c([N+](=O)[O-])c(Oc3cc(C#N)ccc3C(=O)OC(C)(C)C)n2)c1 |
| InChI | InChI=1S/C33H31N7O6/c1-33(2,3)46-31(41)25-14-13-22(19-34)17-26(25)45-30-27(40(42)43)28(36-20-21-9-6-5-7-10-21)37-32(38-30)44-24-12-8-11-23(18-24)29-35-15-16-39(29)4/h5-14,17-18H,15-16,20H2,1-4H3,(H,36,37,38) |
| InChIKey | XBAIPBQMHBWWRO-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 165.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.65 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|