C31H29N5O7 — CID 18916975
tert-butyl 3-[6-(benzylamino)-2-(5-cyano-2-ethoxyphenoxy)-5-nitropyrimidin-4-yl]oxybenzoate (PubChem CID 18916975) has the molecular formula C31H29N5O7 and a molecular weight of 583.60 g/mol. Its IUPAC name is tert-butyl 3-[6-(benzylamino)-2-(5-cyano-2-ethoxyphenoxy)-5-nitropyrimidin-4-yl]oxybenzoate.
| Compound Name | tert-butyl 3-[6-(benzylamino)-2-(5-cyano-2-ethoxyphenoxy)-5-nitropyrimidin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 18916975 |
| Molecular Formula | C31H29N5O7 |
| Molecular Weight | 583.60 g/mol |
| Exact Mass | 583.21 |
| IUPAC Name | tert-butyl 3-[6-(benzylamino)-2-(5-cyano-2-ethoxyphenoxy)-5-nitropyrimidin-4-yl]oxybenzoate |
| SMILES | CCOc1ccc(C#N)cc1Oc1nc(NCc2ccccc2)c([N+](=O)[O-])c(Oc2cccc(C(=O)OC(C)(C)C)c2)n1 |
| InChI | InChI=1S/C31H29N5O7/c1-5-40-24-15-14-21(18-32)16-25(24)42-30-34-27(33-19-20-10-7-6-8-11-20)26(36(38)39)28(35-30)41-23-13-9-12-22(17-23)29(37)43-31(2,3)4/h6-17H,5,19H2,1-4H3,(H,33,34,35) |
| InChIKey | YRNBJBZAQLALAH-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 158.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|