C29H28N6O4 — CID 18916877
tert-butyl 3-[5-amino-4-(3-amino-4-cyanophenoxy)-6-(benzylamino)pyrimidin-2-yl]oxybenzoate (PubChem CID 18916877) has the molecular formula C29H28N6O4 and a molecular weight of 524.58 g/mol. Its IUPAC name is tert-butyl 3-[5-amino-4-(3-amino-4-cyanophenoxy)-6-(benzylamino)pyrimidin-2-yl]oxybenzoate.
| Compound Name | tert-butyl 3-[5-amino-4-(3-amino-4-cyanophenoxy)-6-(benzylamino)pyrimidin-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 18916877 |
| Molecular Formula | C29H28N6O4 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | tert-butyl 3-[5-amino-4-(3-amino-4-cyanophenoxy)-6-(benzylamino)pyrimidin-2-yl]oxybenzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(Oc2nc(NCc3ccccc3)c(N)c(Oc3ccc(C#N)c(N)c3)n2)c1 |
| InChI | InChI=1S/C29H28N6O4/c1-29(2,3)39-27(36)19-10-7-11-21(14-19)38-28-34-25(33-17-18-8-5-4-6-9-18)24(32)26(35-28)37-22-13-12-20(16-30)23(31)15-22/h4-15H,17,31-32H2,1-3H3,(H,33,34,35) |
| InChIKey | QYYSRJLUSJWTQW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 158.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|