C24H21Cl2N5O6 — CID 22103135
ethyl 2-[[6-(2-chloro-5-cyanophenoxy)-2-[3-(2-chloroethyl)-5-methylphenoxy]-5-nitropyrimidin-4-yl]amino]acetate (PubChem CID 22103135) has the molecular formula C24H21Cl2N5O6 and a molecular weight of 546.37 g/mol. Its IUPAC name is ethyl 2-[[6-(2-chloro-5-cyanophenoxy)-2-[3-(2-chloroethyl)-5-methylphenoxy]-5-nitropyrimidin-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[6-(2-chloro-5-cyanophenoxy)-2-[3-(2-chloroethyl)-5-methylphenoxy]-5-nitropyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 22103135 |
| Molecular Formula | C24H21Cl2N5O6 |
| Molecular Weight | 546.37 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | ethyl 2-[[6-(2-chloro-5-cyanophenoxy)-2-[3-(2-chloroethyl)-5-methylphenoxy]-5-nitropyrimidin-4-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1nc(Oc2cc(C)cc(CCCl)c2)nc(Oc2cc(C#N)ccc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21Cl2N5O6/c1-3-35-20(32)13-28-22-21(31(33)34)23(37-19-11-16(12-27)4-5-18(19)26)30-24(29-22)36-17-9-14(2)8-15(10-17)6-7-25/h4-5,8-11H,3,6-7,13H2,1-2H3,(H,28,29,30) |
| InChIKey | IILUCLPABNYOJY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 149.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.37 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|