C19H23N5O6S — CID 22102717
ethyl 2-[[6-[3-(dimethylcarbamoyl)-5-methylphenoxy]-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]acetate (PubChem CID 22102717) has the molecular formula C19H23N5O6S and a molecular weight of 449.49 g/mol. Its IUPAC name is ethyl 2-[[6-[3-(dimethylcarbamoyl)-5-methylphenoxy]-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[6-[3-(dimethylcarbamoyl)-5-methylphenoxy]-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 22102717 |
| Molecular Formula | C19H23N5O6S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | ethyl 2-[[6-[3-(dimethylcarbamoyl)-5-methylphenoxy]-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1nc(SC)nc(Oc2cc(C)cc(C(=O)N(C)C)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23N5O6S/c1-6-29-14(25)10-20-16-15(24(27)28)17(22-19(21-16)31-5)30-13-8-11(2)7-12(9-13)18(26)23(3)4/h7-9H,6,10H2,1-5H3,(H,20,21,22) |
| InChIKey | CXVKSAYCSPFKBI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 136.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|