C24H23N5O10S — CID 22103295
3-[6-[(1-carboxy-2-phenylethyl)amino]-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-5-(dimethylcarbamoyl)benzoic acid (PubChem CID 22103295) has the molecular formula C24H23N5O10S and a molecular weight of 573.54 g/mol. Its IUPAC name is 3-[6-[(1-carboxy-2-phenylethyl)amino]-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-5-(dimethylcarbamoyl)benzoic acid.
| Compound Name | 3-[6-[(1-carboxy-2-phenylethyl)amino]-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-5-(dimethylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 22103295 |
| Molecular Formula | C24H23N5O10S |
| Molecular Weight | 573.54 g/mol |
| Exact Mass | 573.12 |
| IUPAC Name | 3-[6-[(1-carboxy-2-phenylethyl)amino]-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-5-(dimethylcarbamoyl)benzoic acid |
| SMILES | CN(C)C(=O)c1cc(Oc2nc(S(C)(=O)=O)nc(NC(Cc3ccccc3)C(=O)O)c2[N+](=O)[O-])cc(C(=O)O)c1 |
| InChI | InChI=1S/C24H23N5O10S/c1-28(2)21(30)14-10-15(22(31)32)12-16(11-14)39-20-18(29(35)36)19(26-24(27-20)40(3,37)38)25-17(23(33)34)9-13-7-5-4-6-8-13/h4-8,10-12,17H,9H2,1-3H3,(H,31,32)(H,33,34)(H,25,26,27) |
| InChIKey | STFDMLPHWZKMPH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 219.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|