C21H26N6O10S2 — CID 22103198
2-[6-[3-(4,5-dihydro-1H-imidazol-2-yl)-5-(dimethylamino)phenoxy]-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-4-methylsulfonylbutanoic acid (PubChem CID 22103198) has the molecular formula C21H26N6O10S2 and a molecular weight of 586.61 g/mol. Its IUPAC name is 2-[6-[3-(4,5-dihydro-1H-imidazol-2-yl)-5-(dimethylamino)phenoxy]-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-4-methylsulfonylbutanoic acid.
| Compound Name | 2-[6-[3-(4,5-dihydro-1H-imidazol-2-yl)-5-(dimethylamino)phenoxy]-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-4-methylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 22103198 |
| Molecular Formula | C21H26N6O10S2 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 586.12 |
| IUPAC Name | 2-[6-[3-(4,5-dihydro-1H-imidazol-2-yl)-5-(dimethylamino)phenoxy]-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-4-methylsulfonylbutanoic acid |
| SMILES | CN(C)c1cc(Oc2nc(S(C)(=O)=O)nc(OC(CCS(C)(=O)=O)C(=O)O)c2[N+](=O)[O-])cc(C2=NCCN2)c1 |
| InChI | InChI=1S/C21H26N6O10S2/c1-26(2)13-9-12(17-22-6-7-23-17)10-14(11-13)36-18-16(27(30)31)19(25-21(24-18)39(4,34)35)37-15(20(28)29)5-8-38(3,32)33/h9-11,15H,5-8H2,1-4H3,(H,22,23)(H,28,29) |
| InChIKey | WUXKXPIDUWPJIE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 220.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|