C24H22N4O11S — CID 22102522
3-[6-(1-carboxy-2-phenylethoxy)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-5-(dimethylcarbamoyl)benzoic acid (PubChem CID 22102522) has the molecular formula C24H22N4O11S and a molecular weight of 574.52 g/mol. Its IUPAC name is 3-[6-(1-carboxy-2-phenylethoxy)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-5-(dimethylcarbamoyl)benzoic acid.
| Compound Name | 3-[6-(1-carboxy-2-phenylethoxy)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-5-(dimethylcarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 22102522 |
| Molecular Formula | C24H22N4O11S |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | 3-[6-(1-carboxy-2-phenylethoxy)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-5-(dimethylcarbamoyl)benzoic acid |
| SMILES | CN(C)C(=O)c1cc(Oc2nc(S(C)(=O)=O)nc(OC(Cc3ccccc3)C(=O)O)c2[N+](=O)[O-])cc(C(=O)O)c1 |
| InChI | InChI=1S/C24H22N4O11S/c1-27(2)21(29)14-10-15(22(30)31)12-16(11-14)38-19-18(28(34)35)20(26-24(25-19)40(3,36)37)39-17(23(32)33)9-13-7-5-4-6-8-13/h4-8,10-12,17H,9H2,1-3H3,(H,30,31)(H,32,33) |
| InChIKey | WWKLKNQKUGHHOA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 216.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|