C21H24F3N5O8S — CID 22102537
2-[[6-[3-(dimethylcarbamoyl)-5-(trifluoromethyl)phenoxy]-2-methylsulfonyl-5-nitropyrimidin-4-yl]amino]-4-methylpentanoic acid (PubChem CID 22102537) has the molecular formula C21H24F3N5O8S and a molecular weight of 563.51 g/mol. Its IUPAC name is 2-[[6-[3-(dimethylcarbamoyl)-5-(trifluoromethyl)phenoxy]-2-methylsulfonyl-5-nitropyrimidin-4-yl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[6-[3-(dimethylcarbamoyl)-5-(trifluoromethyl)phenoxy]-2-methylsulfonyl-5-nitropyrimidin-4-yl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22102537 |
| Molecular Formula | C21H24F3N5O8S |
| Molecular Weight | 563.51 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 2-[[6-[3-(dimethylcarbamoyl)-5-(trifluoromethyl)phenoxy]-2-methylsulfonyl-5-nitropyrimidin-4-yl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(Nc1nc(S(C)(=O)=O)nc(Oc2cc(C(=O)N(C)C)cc(C(F)(F)F)c2)c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C21H24F3N5O8S/c1-10(2)6-14(19(31)32)25-16-15(29(33)34)17(27-20(26-16)38(5,35)36)37-13-8-11(18(30)28(3)4)7-12(9-13)21(22,23)24/h7-10,14H,6H2,1-5H3,(H,31,32)(H,25,26,27) |
| InChIKey | AYODQEHQARCBNG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 181.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|