C20H25N9O6S — CID 67591312
2-[[6-[4-cyano-3-(dimethylamino)phenoxy]-2-methylsulfinyl-5-nitropyrimidin-4-yl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 67591312) has the molecular formula C20H25N9O6S and a molecular weight of 519.54 g/mol. Its IUPAC name is 2-[[6-[4-cyano-3-(dimethylamino)phenoxy]-2-methylsulfinyl-5-nitropyrimidin-4-yl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[6-[4-cyano-3-(dimethylamino)phenoxy]-2-methylsulfinyl-5-nitropyrimidin-4-yl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 67591312 |
| Molecular Formula | C20H25N9O6S |
| Molecular Weight | 519.54 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 2-[[6-[4-cyano-3-(dimethylamino)phenoxy]-2-methylsulfinyl-5-nitropyrimidin-4-yl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CN(C)c1cc(Oc2nc(S(C)=O)nc(NC(CCCN=C(N)N)C(=O)O)c2[N+](=O)[O-])ccc1C#N |
| InChI | InChI=1S/C20H25N9O6S/c1-28(2)14-9-12(7-6-11(14)10-21)35-17-15(29(32)33)16(26-20(27-17)36(3)34)25-13(18(30)31)5-4-8-24-19(22)23/h6-7,9,13H,4-5,8H2,1-3H3,(H,30,31)(H4,22,23,24)(H,25,26,27) |
| InChIKey | LEVBTBWLHXKSAG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 235.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.54 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|