C18H18N6O8S — CID 67612917
2-[[6-[5-cyano-2-(dimethylamino)phenoxy]-2-methylsulfinyl-5-nitropyrimidin-4-yl]amino]butanedioic acid (PubChem CID 67612917) has the molecular formula C18H18N6O8S and a molecular weight of 478.44 g/mol. Its IUPAC name is 2-[[6-[5-cyano-2-(dimethylamino)phenoxy]-2-methylsulfinyl-5-nitropyrimidin-4-yl]amino]butanedioic acid.
| Compound Name | 2-[[6-[5-cyano-2-(dimethylamino)phenoxy]-2-methylsulfinyl-5-nitropyrimidin-4-yl]amino]butanedioic acid |
|---|---|
| PubChem CID | 67612917 |
| Molecular Formula | C18H18N6O8S |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 2-[[6-[5-cyano-2-(dimethylamino)phenoxy]-2-methylsulfinyl-5-nitropyrimidin-4-yl]amino]butanedioic acid |
| SMILES | CN(C)c1ccc(C#N)cc1Oc1nc(S(C)=O)nc(NC(CC(=O)O)C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H18N6O8S/c1-23(2)11-5-4-9(8-19)6-12(11)32-16-14(24(29)30)15(21-18(22-16)33(3)31)20-10(17(27)28)7-13(25)26/h4-6,10H,7H2,1-3H3,(H,25,26)(H,27,28)(H,20,21,22) |
| InChIKey | WSJZFOYBALSTTK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 208.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|