C18H19N5O5S — CID 22102539
2-[[6-(5-cyano-2-methylphenoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]-3-methylbutanoic acid (PubChem CID 22102539) has the molecular formula C18H19N5O5S and a molecular weight of 417.45 g/mol. Its IUPAC name is 2-[[6-(5-cyano-2-methylphenoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[6-(5-cyano-2-methylphenoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 22102539 |
| Molecular Formula | C18H19N5O5S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[[6-(5-cyano-2-methylphenoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]-3-methylbutanoic acid |
| SMILES | CSc1nc(NC(C(=O)O)C(C)C)c([N+](=O)[O-])c(Oc2cc(C#N)ccc2C)n1 |
| InChI | InChI=1S/C18H19N5O5S/c1-9(2)13(17(24)25)20-15-14(23(26)27)16(22-18(21-15)29-4)28-12-7-11(8-19)6-5-10(12)3/h5-7,9,13H,1-4H3,(H,24,25)(H,20,21,22) |
| InChIKey | PWKHRNIFZVJDMV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 151.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|