C21H22N4O9S — CID 22103229
2-[6-[4-cyano-3-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-3-hydroxybutanoic acid (PubChem CID 22103229) has the molecular formula C21H22N4O9S and a molecular weight of 506.49 g/mol. Its IUPAC name is 2-[6-[4-cyano-3-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-3-hydroxybutanoic acid.
| Compound Name | 2-[6-[4-cyano-3-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 22103229 |
| Molecular Formula | C21H22N4O9S |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 2-[6-[4-cyano-3-[(2-methylpropan-2-yl)oxycarbonyl]phenoxy]-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-3-hydroxybutanoic acid |
| SMILES | CSc1nc(Oc2ccc(C#N)c(C(=O)OC(C)(C)C)c2)c([N+](=O)[O-])c(OC(C(=O)O)C(C)O)n1 |
| InChI | InChI=1S/C21H22N4O9S/c1-10(26)15(18(27)28)33-17-14(25(30)31)16(23-20(24-17)35-5)32-12-7-6-11(9-22)13(8-12)19(29)34-21(2,3)4/h6-8,10,15,26H,1-5H3,(H,27,28) |
| InChIKey | SPWOVKHCUCNTRC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 195.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|