C17H17N5O5S — CID 22102642
ethyl 2-[[6-(4-cyano-3-methylphenoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]acetate (PubChem CID 22102642) has the molecular formula C17H17N5O5S and a molecular weight of 403.42 g/mol. Its IUPAC name is ethyl 2-[[6-(4-cyano-3-methylphenoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[6-(4-cyano-3-methylphenoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]acetate |
|---|---|
| PubChem CID | 22102642 |
| Molecular Formula | C17H17N5O5S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | ethyl 2-[[6-(4-cyano-3-methylphenoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1nc(SC)nc(Oc2ccc(C#N)c(C)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N5O5S/c1-4-26-13(23)9-19-15-14(22(24)25)16(21-17(20-15)28-3)27-12-6-5-11(8-18)10(2)7-12/h5-7H,4,9H2,1-3H3,(H,19,20,21) |
| InChIKey | SVRYTLGYAVSQNR-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|