C13H11N5O5S — CID 22102827
4-(6-amino-2-methylsulfonyl-5-nitropyrimidin-4-yl)oxy-2-methylbenzonitrile (PubChem CID 22102827) has the molecular formula C13H11N5O5S and a molecular weight of 349.33 g/mol. Its IUPAC name is 4-(6-amino-2-methylsulfonyl-5-nitropyrimidin-4-yl)oxy-2-methylbenzonitrile.
| Compound Name | 4-(6-amino-2-methylsulfonyl-5-nitropyrimidin-4-yl)oxy-2-methylbenzonitrile |
|---|---|
| PubChem CID | 22102827 |
| Molecular Formula | C13H11N5O5S |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 4-(6-amino-2-methylsulfonyl-5-nitropyrimidin-4-yl)oxy-2-methylbenzonitrile |
| SMILES | Cc1cc(Oc2nc(S(C)(=O)=O)nc(N)c2[N+](=O)[O-])ccc1C#N |
| InChI | InChI=1S/C13H11N5O5S/c1-7-5-9(4-3-8(7)6-14)23-12-10(18(19)20)11(15)16-13(17-12)24(2,21)22/h3-5H,1-2H3,(H2,15,16,17) |
| InChIKey | LHSGFOMJVTVCBU-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 162.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|