C22H18N4O9S — CID 22102889
ethyl 2-[6-(3-cyano-5-phenoxyphenoxy)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxyacetate (PubChem CID 22102889) has the molecular formula C22H18N4O9S and a molecular weight of 514.47 g/mol. Its IUPAC name is ethyl 2-[6-(3-cyano-5-phenoxyphenoxy)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxyacetate.
| Compound Name | ethyl 2-[6-(3-cyano-5-phenoxyphenoxy)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxyacetate |
|---|---|
| PubChem CID | 22102889 |
| Molecular Formula | C22H18N4O9S |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | ethyl 2-[6-(3-cyano-5-phenoxyphenoxy)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxyacetate |
| SMILES | CCOC(=O)COc1nc(S(C)(=O)=O)nc(Oc2cc(C#N)cc(Oc3ccccc3)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H18N4O9S/c1-3-32-18(27)13-33-20-19(26(28)29)21(25-22(24-20)36(2,30)31)35-17-10-14(12-23)9-16(11-17)34-15-7-5-4-6-8-15/h4-11H,3,13H2,1-2H3 |
| InChIKey | PPXSYVLDCFKPRK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 180.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|