C19H19N7O5S — CID 18916859
2-[3-[6-(benzylamino)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxyphenyl]guanidine (PubChem CID 18916859) has the molecular formula C19H19N7O5S and a molecular weight of 457.47 g/mol. Its IUPAC name is 2-[3-[6-(benzylamino)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxyphenyl]guanidine.
| Compound Name | 2-[3-[6-(benzylamino)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxyphenyl]guanidine |
|---|---|
| PubChem CID | 18916859 |
| Molecular Formula | C19H19N7O5S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[3-[6-(benzylamino)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxyphenyl]guanidine |
| SMILES | CS(=O)(=O)c1nc(NCc2ccccc2)c([N+](=O)[O-])c(Oc2cccc(N=C(N)N)c2)n1 |
| InChI | InChI=1S/C19H19N7O5S/c1-32(29,30)19-24-16(22-11-12-6-3-2-4-7-12)15(26(27)28)17(25-19)31-14-9-5-8-13(10-14)23-18(20)21/h2-10H,11H2,1H3,(H4,20,21,23)(H,22,24,25) |
| InChIKey | OBXYRBKIKOGDAU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 188.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|