C23H24ClN5O4S — CID 18916814
3-[3-[6-(benzylamino)-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-5-chlorophenyl]-N,N-dimethylpropanamide (PubChem CID 18916814) has the molecular formula C23H24ClN5O4S and a molecular weight of 502.00 g/mol. Its IUPAC name is 3-[3-[6-(benzylamino)-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-5-chlorophenyl]-N,N-dimethylpropanamide.
| Compound Name | 3-[3-[6-(benzylamino)-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-5-chlorophenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 18916814 |
| Molecular Formula | C23H24ClN5O4S |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 3-[3-[6-(benzylamino)-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-5-chlorophenyl]-N,N-dimethylpropanamide |
| SMILES | CSc1nc(NCc2ccccc2)c([N+](=O)[O-])c(Oc2cc(Cl)cc(CCC(=O)N(C)C)c2)n1 |
| InChI | InChI=1S/C23H24ClN5O4S/c1-28(2)19(30)10-9-16-11-17(24)13-18(12-16)33-22-20(29(31)32)21(26-23(27-22)34-3)25-14-15-7-5-4-6-8-15/h4-8,11-13H,9-10,14H2,1-3H3,(H,25,26,27) |
| InChIKey | ALHIZLYEYXHWOJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|