C24H29N5O8S — CID 22103005
ethyl 3-[3-[6-(2-ethoxy-2-oxoethoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-5-(1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]propanoate (PubChem CID 22103005) has the molecular formula C24H29N5O8S and a molecular weight of 547.59 g/mol. Its IUPAC name is ethyl 3-[3-[6-(2-ethoxy-2-oxoethoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-5-(1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]propanoate.
| Compound Name | ethyl 3-[3-[6-(2-ethoxy-2-oxoethoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-5-(1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 22103005 |
| Molecular Formula | C24H29N5O8S |
| Molecular Weight | 547.59 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | ethyl 3-[3-[6-(2-ethoxy-2-oxoethoxy)-2-methylsulfanyl-5-nitropyrimidin-4-yl]oxy-5-(1,2,3,4-tetrahydropyrimidin-2-yl)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1cc(Oc2nc(SC)nc(OCC(=O)OCC)c2[N+](=O)[O-])cc(C2NC=CCN2)c1 |
| InChI | InChI=1S/C24H29N5O8S/c1-4-34-18(30)8-7-15-11-16(21-25-9-6-10-26-21)13-17(12-15)37-23-20(29(32)33)22(27-24(28-23)38-3)36-14-19(31)35-5-2/h6,9,11-13,21,25-26H,4-5,7-8,10,14H2,1-3H3 |
| InChIKey | QOPCWSQFFJWXKW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 164.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|