C16H16Cl2N4O4S — CID 18917041
3-[3-chloro-5-(6-chloro-2-methylsulfanyl-5-nitropyrimidin-4-yl)oxyphenyl]-N,N-dimethylpropanamide (PubChem CID 18917041) has the molecular formula C16H16Cl2N4O4S and a molecular weight of 431.30 g/mol. Its IUPAC name is 3-[3-chloro-5-(6-chloro-2-methylsulfanyl-5-nitropyrimidin-4-yl)oxyphenyl]-N,N-dimethylpropanamide.
| Compound Name | 3-[3-chloro-5-(6-chloro-2-methylsulfanyl-5-nitropyrimidin-4-yl)oxyphenyl]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 18917041 |
| Molecular Formula | C16H16Cl2N4O4S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 430.03 |
| IUPAC Name | 3-[3-chloro-5-(6-chloro-2-methylsulfanyl-5-nitropyrimidin-4-yl)oxyphenyl]-N,N-dimethylpropanamide |
| SMILES | CSc1nc(Cl)c([N+](=O)[O-])c(Oc2cc(Cl)cc(CCC(=O)N(C)C)c2)n1 |
| InChI | InChI=1S/C16H16Cl2N4O4S/c1-21(2)12(23)5-4-9-6-10(17)8-11(7-9)26-15-13(22(24)25)14(18)19-16(20-15)27-3/h6-8H,4-5H2,1-3H3 |
| InChIKey | SSWYYYZANBZCJY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|