C24H22N8O8S — CID 21469137
2-[6-[(1-carboxy-3-methylsulfanylpropyl)amino]-2-[3-(diaminomethylideneamino)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-cyanobenzoic acid (PubChem CID 21469137) has the molecular formula C24H22N8O8S and a molecular weight of 582.56 g/mol. Its IUPAC name is 2-[6-[(1-carboxy-3-methylsulfanylpropyl)amino]-2-[3-(diaminomethylideneamino)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-cyanobenzoic acid.
| Compound Name | 2-[6-[(1-carboxy-3-methylsulfanylpropyl)amino]-2-[3-(diaminomethylideneamino)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-cyanobenzoic acid |
|---|---|
| PubChem CID | 21469137 |
| Molecular Formula | C24H22N8O8S |
| Molecular Weight | 582.56 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | 2-[6-[(1-carboxy-3-methylsulfanylpropyl)amino]-2-[3-(diaminomethylideneamino)phenoxy]-5-nitropyrimidin-4-yl]oxy-4-cyanobenzoic acid |
| SMILES | CSCCC(Nc1nc(Oc2cccc(N=C(N)N)c2)nc(Oc2cc(C#N)ccc2C(=O)O)c1[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C24H22N8O8S/c1-41-8-7-16(22(35)36)29-19-18(32(37)38)20(40-17-9-12(11-25)5-6-15(17)21(33)34)31-24(30-19)39-14-4-2-3-13(10-14)28-23(26)27/h2-6,9-10,16H,7-8H2,1H3,(H,33,34)(H,35,36)(H4,26,27,28)(H,29,30,31) |
| InChIKey | KIESOYGIWZWUEH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 262.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.56 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|