C21H19N5O6S — CID 18916946
3-[6-(benzylamino)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-4-ethoxybenzonitrile (PubChem CID 18916946) has the molecular formula C21H19N5O6S and a molecular weight of 469.48 g/mol. Its IUPAC name is 3-[6-(benzylamino)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-4-ethoxybenzonitrile.
| Compound Name | 3-[6-(benzylamino)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-4-ethoxybenzonitrile |
|---|---|
| PubChem CID | 18916946 |
| Molecular Formula | C21H19N5O6S |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 3-[6-(benzylamino)-2-methylsulfonyl-5-nitropyrimidin-4-yl]oxy-4-ethoxybenzonitrile |
| SMILES | CCOc1ccc(C#N)cc1Oc1nc(S(C)(=O)=O)nc(NCc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H19N5O6S/c1-3-31-16-10-9-15(12-22)11-17(16)32-20-18(26(27)28)19(24-21(25-20)33(2,29)30)23-13-14-7-5-4-6-8-14/h4-11H,3,13H2,1-2H3,(H,23,24,25) |
| InChIKey | YSRRHQPTWSKTSB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 157.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|