C16H10N4O4 — CID 133282842
3-methyl-4-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)oxybenzonitrile (PubChem CID 133282842) has the molecular formula C16H10N4O4 and a molecular weight of 322.28 g/mol. Its IUPAC name is 3-methyl-4-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)oxybenzonitrile.
| Compound Name | 3-methyl-4-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 133282842 |
| Molecular Formula | C16H10N4O4 |
| Molecular Weight | 322.28 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 3-methyl-4-(3-nitro-4-oxopyrido[1,2-a]pyrimidin-2-yl)oxybenzonitrile |
| SMILES | Cc1cc(C#N)ccc1Oc1nc2ccccn2c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H10N4O4/c1-10-8-11(9-17)5-6-12(10)24-15-14(20(22)23)16(21)19-7-3-2-4-13(19)18-15/h2-8H,1H3 |
| InChIKey | PIGKJRLNFAKTDD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 110.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|