C14H7Cl2N3O4 — CID 55522452
2-(3,5-dichlorophenoxy)-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 55522452) has the molecular formula C14H7Cl2N3O4 and a molecular weight of 352.13 g/mol. Its IUPAC name is 2-(3,5-dichlorophenoxy)-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(3,5-dichlorophenoxy)-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 55522452 |
| Molecular Formula | C14H7Cl2N3O4 |
| Molecular Weight | 352.13 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 2-(3,5-dichlorophenoxy)-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(Oc2cc(Cl)cc(Cl)c2)nc2ccccn12 |
| InChI | InChI=1S/C14H7Cl2N3O4/c15-8-5-9(16)7-10(6-8)23-13-12(19(21)22)14(20)18-4-2-1-3-11(18)17-13/h1-7H |
| InChIKey | JKROQPGWSMZYRG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.13 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|