C18H16ClN5O5S — CID 46560149
2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 46560149) has the molecular formula C18H16ClN5O5S and a molecular weight of 449.88 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 46560149 |
| Molecular Formula | C18H16ClN5O5S |
| Molecular Weight | 449.88 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(N2CCN(S(=O)(=O)c3cccc(Cl)c3)CC2)nc2ccccn12 |
| InChI | InChI=1S/C18H16ClN5O5S/c19-13-4-3-5-14(12-13)30(28,29)22-10-8-21(9-11-22)17-16(24(26)27)18(25)23-7-2-1-6-15(23)20-17/h1-7,12H,8-11H2 |
| InChIKey | IRVRUQVKASGONS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 118.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.88 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|