C28H30N8O4 — CID 151402620
tert-butyl 2-[1-butyl-2-[3-(diaminomethylideneamino)phenoxy]purin-6-yl]oxy-4-cyanobenzoate (PubChem CID 151402620) has the molecular formula C28H30N8O4 and a molecular weight of 542.60 g/mol. Its IUPAC name is tert-butyl 2-[1-butyl-2-[3-(diaminomethylideneamino)phenoxy]purin-6-yl]oxy-4-cyanobenzoate.
| Compound Name | tert-butyl 2-[1-butyl-2-[3-(diaminomethylideneamino)phenoxy]purin-6-yl]oxy-4-cyanobenzoate |
|---|---|
| PubChem CID | 151402620 |
| Molecular Formula | C28H30N8O4 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | tert-butyl 2-[1-butyl-2-[3-(diaminomethylideneamino)phenoxy]purin-6-yl]oxy-4-cyanobenzoate |
| SMILES | CCCCn1c(Oc2cccc(N=C(N)N)c2)nc2ncnc-2c1Oc1cc(C#N)ccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H30N8O4/c1-5-6-12-36-24(39-21-13-17(15-29)10-11-20(21)25(37)40-28(2,3)4)22-23(33-16-32-22)35-27(36)38-19-9-7-8-18(14-19)34-26(30)31/h7-11,13-14,16H,5-6,12H2,1-4H3,(H4,30,31,34) |
| InChIKey | OWVBMMGBJHMAME-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 176.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|