C16H21F3N2O3 — CID 151171109
4-methyl-3-[[2-(2-methylpropylamino)-5-(trifluoromethoxy)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 151171109) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is 4-methyl-3-[[2-(2-methylpropylamino)-5-(trifluoromethoxy)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-methyl-3-[[2-(2-methylpropylamino)-5-(trifluoromethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 151171109 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 4-methyl-3-[[2-(2-methylpropylamino)-5-(trifluoromethoxy)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)CNc1ccc(OC(F)(F)F)cc1CN1C(=O)OCC1C |
| InChI | InChI=1S/C16H21F3N2O3/c1-10(2)7-20-14-5-4-13(24-16(17,18)19)6-12(14)8-21-11(3)9-23-15(21)22/h4-6,10-11,20H,7-9H2,1-3H3 |
| InChIKey | NCHGPPYVLNVXNH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|