C36H21BrN4O — CID 151172267
5-[3-bromo-5-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]quinoline (PubChem CID 151172267) has the molecular formula C36H21BrN4O and a molecular weight of 605.50 g/mol. Its IUPAC name is 5-[3-bromo-5-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]quinoline.
| Compound Name | 5-[3-bromo-5-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]quinoline |
|---|---|
| PubChem CID | 151172267 |
| Molecular Formula | C36H21BrN4O |
| Molecular Weight | 605.50 g/mol |
| Exact Mass | 604.09 |
| IUPAC Name | 5-[3-bromo-5-(4-dibenzofuran-4-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]quinoline |
| SMILES | Brc1cc(-c2nc(-c3ccccc3)nc(-c3cccc4c3oc3ccccc34)n2)cc(-c2cccc3ncccc23)c1 |
| InChI | InChI=1S/C36H21BrN4O/c37-25-20-23(26-12-7-16-31-27(26)15-8-18-38-31)19-24(21-25)35-39-34(22-9-2-1-3-10-22)40-36(41-35)30-14-6-13-29-28-11-4-5-17-32(28)42-33(29)30/h1-21H |
| InChIKey | NCNLLKXXPWTGOJ-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.50 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |