C12H18N2O5S — CID 15118197
2-[(3-ethoxyphenyl)methylsulfonyl-methylamino]-N-hydroxyacetamide (PubChem CID 15118197) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-[(3-ethoxyphenyl)methylsulfonyl-methylamino]-N-hydroxyacetamide.
| Compound Name | 2-[(3-ethoxyphenyl)methylsulfonyl-methylamino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 15118197 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[(3-ethoxyphenyl)methylsulfonyl-methylamino]-N-hydroxyacetamide |
| SMILES | CCOc1cccc(CS(=O)(=O)N(C)CC(=O)NO)c1 |
| InChI | InChI=1S/C12H18N2O5S/c1-3-19-11-6-4-5-10(7-11)9-20(17,18)14(2)8-12(15)13-16/h4-7,16H,3,8-9H2,1-2H3,(H,13,15) |
| InChIKey | OKPSDXYTWNGKPC-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|