C10H11INO4S- — CID 19837738
2-[(3-iodophenyl)methylsulfonyl-methylamino]acetate (PubChem CID 19837738) has the molecular formula C10H11INO4S- and a molecular weight of 368.17 g/mol. Its IUPAC name is 2-[(3-iodophenyl)methylsulfonyl-methylamino]acetate.
| Compound Name | 2-[(3-iodophenyl)methylsulfonyl-methylamino]acetate |
|---|---|
| PubChem CID | 19837738 |
| Molecular Formula | C10H11INO4S- |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 367.95 |
| IUPAC Name | 2-[(3-iodophenyl)methylsulfonyl-methylamino]acetate |
| SMILES | CN(CC(=O)[O-])S(=O)(=O)Cc1cccc(I)c1 |
| InChI | InChI=1S/C10H12INO4S/c1-12(6-10(13)14)17(15,16)7-8-3-2-4-9(11)5-8/h2-5H,6-7H2,1H3,(H,13,14)/p-1 |
| InChIKey | IVJVYJRTIWBAAQ-UHFFFAOYSA-M |
| XLogP | -0.20 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|