C11H11F3NO4S- — CID 19837767
2-[methyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetate (PubChem CID 19837767) has the molecular formula C11H11F3NO4S- and a molecular weight of 310.27 g/mol. Its IUPAC name is 2-[methyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetate.
| Compound Name | 2-[methyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetate |
|---|---|
| PubChem CID | 19837767 |
| Molecular Formula | C11H11F3NO4S- |
| Molecular Weight | 310.27 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-[methyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetate |
| SMILES | CN(CC(=O)[O-])S(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H12F3NO4S/c1-15(6-10(16)17)20(18,19)7-8-3-2-4-9(5-8)11(12,13)14/h2-5H,6-7H2,1H3,(H,16,17)/p-1 |
| InChIKey | LDYLPVCEDISOEM-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |