C13H15F3N2O4S — CID 15118290
2-[oxiran-2-ylmethyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetamide (PubChem CID 15118290) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is 2-[oxiran-2-ylmethyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetamide.
| Compound Name | 2-[oxiran-2-ylmethyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetamide |
|---|---|
| PubChem CID | 15118290 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 2-[oxiran-2-ylmethyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetamide |
| SMILES | NC(=O)CN(CC1CO1)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O4S/c14-13(15,16)10-3-1-2-9(4-10)8-23(20,21)18(6-12(17)19)5-11-7-22-11/h1-4,11H,5-8H2,(H2,17,19) |
| InChIKey | KEZUZKKDXQEOFP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|