C15H24N2O2S2 — CID 19837719
2-[(3-tert-butylphenyl)methylsulfonyl-ethylamino]ethanethioamide (PubChem CID 19837719) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 2-[(3-tert-butylphenyl)methylsulfonyl-ethylamino]ethanethioamide.
| Compound Name | 2-[(3-tert-butylphenyl)methylsulfonyl-ethylamino]ethanethioamide |
|---|---|
| PubChem CID | 19837719 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 2-[(3-tert-butylphenyl)methylsulfonyl-ethylamino]ethanethioamide |
| SMILES | CCN(CC(N)=S)S(=O)(=O)Cc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24N2O2S2/c1-5-17(10-14(16)20)21(18,19)11-12-7-6-8-13(9-12)15(2,3)4/h6-9H,5,10-11H2,1-4H3,(H2,16,20) |
| InChIKey | UOMKOQPXCCWBGU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|