C12H15N3O3S2 — CID 15118387
2-[cyanomethyl-[(3-methoxyphenyl)methylsulfonyl]amino]ethanethioamide (PubChem CID 15118387) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[cyanomethyl-[(3-methoxyphenyl)methylsulfonyl]amino]ethanethioamide.
| Compound Name | 2-[cyanomethyl-[(3-methoxyphenyl)methylsulfonyl]amino]ethanethioamide |
|---|---|
| PubChem CID | 15118387 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 2-[cyanomethyl-[(3-methoxyphenyl)methylsulfonyl]amino]ethanethioamide |
| SMILES | COc1cccc(CS(=O)(=O)N(CC#N)CC(N)=S)c1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-18-11-4-2-3-10(7-11)9-20(16,17)15(6-5-13)8-12(14)19/h2-4,7H,6,8-9H2,1H3,(H2,14,19) |
| InChIKey | RMBPRPJLLDICJI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 96.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|