C16H19F3N2O2S — CID 57155893
N-(cyanomethyl)-N-hex-4-enyl-1-[3-(trifluoromethyl)phenyl]methanesulfonamide (PubChem CID 57155893) has the molecular formula C16H19F3N2O2S and a molecular weight of 360.40 g/mol. Its IUPAC name is N-(cyanomethyl)-N-hex-4-enyl-1-[3-(trifluoromethyl)phenyl]methanesulfonamide.
| Compound Name | N-(cyanomethyl)-N-hex-4-enyl-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 57155893 |
| Molecular Formula | C16H19F3N2O2S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | N-(cyanomethyl)-N-hex-4-enyl-1-[3-(trifluoromethyl)phenyl]methanesulfonamide |
| SMILES | CC=CCCCN(CC#N)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F3N2O2S/c1-2-3-4-5-10-21(11-9-20)24(22,23)13-14-7-6-8-15(12-14)16(17,18)19/h2-3,6-8,12H,4-5,10-11,13H2,1H3 |
| InChIKey | PYOWBVNOZBKZSH-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|