C13H15F3N2O3S — CID 15118088
2-[cyclopropyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetamide (PubChem CID 15118088) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is 2-[cyclopropyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetamide.
| Compound Name | 2-[cyclopropyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetamide |
|---|---|
| PubChem CID | 15118088 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2-[cyclopropyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]acetamide |
| SMILES | NC(=O)CN(C1CC1)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O3S/c14-13(15,16)10-3-1-2-9(6-10)8-22(20,21)18(7-12(17)19)11-4-5-11/h1-3,6,11H,4-5,7-8H2,(H2,17,19) |
| InChIKey | TZRKNHJGYKCLMJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |