C11H12N4O4S2 — CID 15118389
2-[cyanomethyl-[(3-nitrophenyl)methylsulfonyl]amino]ethanethioamide (PubChem CID 15118389) has the molecular formula C11H12N4O4S2 and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-[cyanomethyl-[(3-nitrophenyl)methylsulfonyl]amino]ethanethioamide.
| Compound Name | 2-[cyanomethyl-[(3-nitrophenyl)methylsulfonyl]amino]ethanethioamide |
|---|---|
| PubChem CID | 15118389 |
| Molecular Formula | C11H12N4O4S2 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-[cyanomethyl-[(3-nitrophenyl)methylsulfonyl]amino]ethanethioamide |
| SMILES | N#CCN(CC(N)=S)S(=O)(=O)Cc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H12N4O4S2/c12-4-5-14(7-11(13)20)21(18,19)8-9-2-1-3-10(6-9)15(16)17/h1-3,6H,5,7-8H2,(H2,13,20) |
| InChIKey | ICDILMWAJUTGDY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|