C31H49NO3 — CID 151190765
N-(2,2-dimethylundecyl)-N-octyl-4-oxochromene-2-carboxamide (PubChem CID 151190765) has the molecular formula C31H49NO3 and a molecular weight of 483.74 g/mol. Its IUPAC name is N-(2,2-dimethylundecyl)-N-octyl-4-oxochromene-2-carboxamide.
| Compound Name | N-(2,2-dimethylundecyl)-N-octyl-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 151190765 |
| Molecular Formula | C31H49NO3 |
| Molecular Weight | 483.74 g/mol |
| Exact Mass | 483.37 |
| IUPAC Name | N-(2,2-dimethylundecyl)-N-octyl-4-oxochromene-2-carboxamide |
| SMILES | CCCCCCCCCC(C)(C)CN(CCCCCCCC)C(=O)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C31H49NO3/c1-5-7-9-11-13-14-18-22-31(3,4)25-32(23-19-15-12-10-8-6-2)30(34)29-24-27(33)26-20-16-17-21-28(26)35-29/h16-17,20-21,24H,5-15,18-19,22-23,25H2,1-4H3 |
| InChIKey | NGGPENVGVTZWBF-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.74 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|