C12H16O6 — CID 15119300
methyl (E)-3-[(1R,2R,6R,7R,9S)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-9-yl]prop-2-enoate (PubChem CID 15119300) has the molecular formula C12H16O6 and a molecular weight of 256.25 g/mol. Its IUPAC name is methyl (E)-3-[(1R,2R,6R,7R,9S)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-9-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1R,2R,6R,7R,9S)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-9-yl]prop-2-enoate |
|---|---|
| PubChem CID | 15119300 |
| Molecular Formula | C12H16O6 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | methyl (E)-3-[(1R,2R,6R,7R,9S)-4,4-dimethyl-3,5,8,10-tetraoxatricyclo[5.2.1.02,6]decan-9-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1O[C@@H]2O[C@H]1[C@H]1OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H16O6/c1-12(2)17-9-8-6(4-5-7(13)14-3)15-11(16-8)10(9)18-12/h4-6,8-11H,1-3H3/b5-4+/t6-,8+,9+,10+,11+/m0/s1 |
| InChIKey | WYKMTHXMMLTYGL-IXLJAHRTSA-N |
| XLogP | 0.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|